C18H26N2O — CID 81303160
2-ethyl-N-(2,4,4-trimethylcyclohexyl)-1,3-benzoxazol-5-amine (PubChem CID 81303160) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is 2-ethyl-N-(2,4,4-trimethylcyclohexyl)-1,3-benzoxazol-5-amine.
| Compound Name | 2-ethyl-N-(2,4,4-trimethylcyclohexyl)-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 81303160 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | 2-ethyl-N-(2,4,4-trimethylcyclohexyl)-1,3-benzoxazol-5-amine |
| SMILES | CCc1nc2cc(NC3CCC(C)(C)CC3C)ccc2o1 |
| InChI | InChI=1S/C18H26N2O/c1-5-17-20-15-10-13(6-7-16(15)21-17)19-14-8-9-18(3,4)11-12(14)2/h6-7,10,12,14,19H,5,8-9,11H2,1-4H3 |
| InChIKey | GLKWJXPRVUHEEQ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |