C17H15NO2 — CID 81305874
2-(2,3-dihydro-1H-inden-5-yloxy)-4-methoxybenzonitrile (PubChem CID 81305874) has the molecular formula C17H15NO2 and a molecular weight of 265.31 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-5-yloxy)-4-methoxybenzonitrile.
| Compound Name | 2-(2,3-dihydro-1H-inden-5-yloxy)-4-methoxybenzonitrile |
|---|---|
| PubChem CID | 81305874 |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-5-yloxy)-4-methoxybenzonitrile |
| SMILES | COc1ccc(C#N)c(Oc2ccc3c(c2)CCC3)c1 |
| InChI | InChI=1S/C17H15NO2/c1-19-15-7-6-14(11-18)17(10-15)20-16-8-5-12-3-2-4-13(12)9-16/h5-10H,2-4H2,1H3 |
| InChIKey | XKVLOYKOIIIUDN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |