C12H13F3N2O4 — CID 81308626
methyl 2-acetamido-3-[2-oxo-6-(trifluoromethyl)-1-pyridinyl]propanoate (PubChem CID 81308626) has the molecular formula C12H13F3N2O4 and a molecular weight of 306.24 g/mol. Its IUPAC name is methyl 2-acetamido-3-[2-oxo-6-(trifluoromethyl)-1-pyridinyl]propanoate.
| Compound Name | methyl 2-acetamido-3-[2-oxo-6-(trifluoromethyl)-1-pyridinyl]propanoate |
|---|---|
| PubChem CID | 81308626 |
| Molecular Formula | C12H13F3N2O4 |
| Molecular Weight | 306.24 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | methyl 2-acetamido-3-[2-oxo-6-(trifluoromethyl)-1-pyridinyl]propanoate |
| SMILES | COC(=O)C(Cn1c(C(F)(F)F)cccc1=O)NC(C)=O |
| InChI | InChI=1S/C12H13F3N2O4/c1-7(18)16-8(11(20)21-2)6-17-9(12(13,14)15)4-3-5-10(17)19/h3-5,8H,6H2,1-2H3,(H,16,18) |
| InChIKey | FIJOAMLNCVQFOY-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.24 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |