C13H12F2N2O2S — CID 81310580
2,4-difluoro-N-[1-(5-methylthiophen-2-yl)ethyl]-6-nitroaniline (PubChem CID 81310580) has the molecular formula C13H12F2N2O2S and a molecular weight of 298.31 g/mol. Its IUPAC name is 2,4-difluoro-N-[1-(5-methylthiophen-2-yl)ethyl]-6-nitroaniline.
| Compound Name | 2,4-difluoro-N-[1-(5-methylthiophen-2-yl)ethyl]-6-nitroaniline |
|---|---|
| PubChem CID | 81310580 |
| Molecular Formula | C13H12F2N2O2S |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 2,4-difluoro-N-[1-(5-methylthiophen-2-yl)ethyl]-6-nitroaniline |
| SMILES | Cc1ccc(C(C)Nc2c(F)cc(F)cc2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C13H12F2N2O2S/c1-7-3-4-12(20-7)8(2)16-13-10(15)5-9(14)6-11(13)17(18)19/h3-6,8,16H,1-2H3 |
| InChIKey | DUAWLXXBGWBVAK-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|