C15H23F3N2O — CID 81310661
1-[2-(5-methylhexan-2-ylamino)ethyl]-6-(trifluoromethyl)pyridin-2-one (PubChem CID 81310661) has the molecular formula C15H23F3N2O and a molecular weight of 304.36 g/mol. Its IUPAC name is 1-[2-(5-methylhexan-2-ylamino)ethyl]-6-(trifluoromethyl)pyridin-2-one.
| Compound Name | 1-[2-(5-methylhexan-2-ylamino)ethyl]-6-(trifluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 81310661 |
| Molecular Formula | C15H23F3N2O |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 1-[2-(5-methylhexan-2-ylamino)ethyl]-6-(trifluoromethyl)pyridin-2-one |
| SMILES | CC(C)CCC(C)NCCn1c(C(F)(F)F)cccc1=O |
| InChI | InChI=1S/C15H23F3N2O/c1-11(2)7-8-12(3)19-9-10-20-13(15(16,17)18)5-4-6-14(20)21/h4-6,11-12,19H,7-10H2,1-3H3 |
| InChIKey | QRCFINMDMXPZII-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |