C14H11F3N2OS — CID 81310731
1-[[3-(3-aminoprop-1-ynyl)thiophen-2-yl]methyl]-6-(trifluoromethyl)pyridin-2-one (PubChem CID 81310731) has the molecular formula C14H11F3N2OS and a molecular weight of 312.32 g/mol. Its IUPAC name is 1-[[3-(3-aminoprop-1-ynyl)thiophen-2-yl]methyl]-6-(trifluoromethyl)pyridin-2-one.
| Compound Name | 1-[[3-(3-aminoprop-1-ynyl)thiophen-2-yl]methyl]-6-(trifluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 81310731 |
| Molecular Formula | C14H11F3N2OS |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 1-[[3-(3-aminoprop-1-ynyl)thiophen-2-yl]methyl]-6-(trifluoromethyl)pyridin-2-one |
| SMILES | NCC#Cc1ccsc1Cn1c(C(F)(F)F)cccc1=O |
| InChI | InChI=1S/C14H11F3N2OS/c15-14(16,17)12-4-1-5-13(20)19(12)9-11-10(3-2-7-18)6-8-21-11/h1,4-6,8H,7,9,18H2 |
| InChIKey | AUJAZMOBAUDBRF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|