C11H14FN3O3 — CID 81310912
N-(2-fluoro-6-nitrophenyl)-4-(methylamino)butanamide (PubChem CID 81310912) has the molecular formula C11H14FN3O3 and a molecular weight of 255.25 g/mol. Its IUPAC name is N-(2-fluoro-6-nitrophenyl)-4-(methylamino)butanamide.
| Compound Name | N-(2-fluoro-6-nitrophenyl)-4-(methylamino)butanamide |
|---|---|
| PubChem CID | 81310912 |
| Molecular Formula | C11H14FN3O3 |
| Molecular Weight | 255.25 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | N-(2-fluoro-6-nitrophenyl)-4-(methylamino)butanamide |
| SMILES | CNCCCC(=O)Nc1c(F)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H14FN3O3/c1-13-7-3-6-10(16)14-11-8(12)4-2-5-9(11)15(17)18/h2,4-5,13H,3,6-7H2,1H3,(H,14,16) |
| InChIKey | QNPVRLWCCCCFRJ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.25 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|