About 4-N,4-N-dimethyl-1-N-[(5-methyl-2-pyridinyl)methyl]benzene-1,4-diamine
4-N,4-N-dimethyl-1-N-[(5-methyl-2-pyridinyl)methyl]benzene-1,4-diamine (PubChem CID 81313245) has the molecular formula C15H19N3
and a molecular weight of 241.34 g/mol. Its IUPAC name is 4-N,4-N-dimethyl-1-N-[(5-methyl-2-pyridinyl)methyl]benzene-1,4-diamine.
Molecular Properties
| Compound Name | 4-N,4-N-dimethyl-1-N-[(5-methyl-2-pyridinyl)methyl]benzene-1,4-diamine |
| PubChem CID | 81313245 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 4-N,4-N-dimethyl-1-N-[(5-methyl-2-pyridinyl)methyl]benzene-1,4-diamine |
| SMILES | Cc1ccc(CNc2ccc(N(C)C)cc2)nc1 |
| InChI | InChI=1S/C15H19N3/c1-12-4-5-14(16-10-12)11-17-13-6-8-15(9-7-13)18(2)3/h4-10,17H,11H2,1-3H3 |
| InChIKey | NXGSMGKVVXQGDU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze 4-N,4-N-dimethyl-1-N-[(5-methyl-2-pyridinyl)methyl]benzene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N,4-N-dimethyl-1-N-[(5-methyl-2-pyridinyl)methyl]benzene-1,4-diamine?
The IUPAC name of 4-N,4-N-dimethyl-1-N-[(5-methyl-2-pyridinyl)methyl]benzene-1,4-diamine (CID 81313245) is 4-N,4-N-dimethyl-1-N-[(5-methyl-2-pyridinyl)methyl]benzene-1,4-diamine.
What is the SMILES notation for 4-N,4-N-dimethyl-1-N-[(5-methyl-2-pyridinyl)methyl]benzene-1,4-diamine?
The canonical SMILES for 4-N,4-N-dimethyl-1-N-[(5-methyl-2-pyridinyl)methyl]benzene-1,4-diamine is Cc1ccc(CNc2ccc(N(C)C)cc2)nc1.
What is the InChIKey of 4-N,4-N-dimethyl-1-N-[(5-methyl-2-pyridinyl)methyl]benzene-1,4-diamine?
The InChIKey is NXGSMGKVVXQGDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3/c1-12-4-5-14(16-10-12)11-17-13-6-8-15(9-7-13)18(2)3/h4-10,17H,11H2,1-3H3.
What are the key properties of 4-N,4-N-dimethyl-1-N-[(5-methyl-2-pyridinyl)methyl]benzene-1,4-diamine?
4-N,4-N-dimethyl-1-N-[(5-methyl-2-pyridinyl)methyl]benzene-1,4-diamine has a molecular weight of 241.34 g/mol, XLogP of 3.07, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N,4-N-dimethyl-1-N-[(5-methyl-2-pyridinyl)methyl]benzene-1,4-diamine is sourced from PubChem (CID 81313245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).