About 2-hydroxy-2-(2,4,4-trimethylcyclohexyl)propanoic acid
2-hydroxy-2-(2,4,4-trimethylcyclohexyl)propanoic acid (PubChem CID 81313663) has the molecular formula C12H22O3
and a molecular weight of 214.30 g/mol. Its IUPAC name is 2-hydroxy-2-(2,4,4-trimethylcyclohexyl)propanoic acid.
Molecular Properties
| Compound Name | 2-hydroxy-2-(2,4,4-trimethylcyclohexyl)propanoic acid |
| PubChem CID | 81313663 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | 2-hydroxy-2-(2,4,4-trimethylcyclohexyl)propanoic acid |
| SMILES | CC1CC(C)(C)CCC1C(C)(O)C(=O)O |
| InChI | InChI=1S/C12H22O3/c1-8-7-11(2,3)6-5-9(8)12(4,15)10(13)14/h8-9,15H,5-7H2,1-4H3,(H,13,14) |
| InChIKey | IZJOHEDMJPKFHP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-hydroxy-2-(2,4,4-trimethylcyclohexyl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-2-(2,4,4-trimethylcyclohexyl)propanoic acid?
The IUPAC name of 2-hydroxy-2-(2,4,4-trimethylcyclohexyl)propanoic acid (CID 81313663) is 2-hydroxy-2-(2,4,4-trimethylcyclohexyl)propanoic acid.
What is the SMILES notation for 2-hydroxy-2-(2,4,4-trimethylcyclohexyl)propanoic acid?
The canonical SMILES for 2-hydroxy-2-(2,4,4-trimethylcyclohexyl)propanoic acid is CC1CC(C)(C)CCC1C(C)(O)C(=O)O.
What is the InChIKey of 2-hydroxy-2-(2,4,4-trimethylcyclohexyl)propanoic acid?
The InChIKey is IZJOHEDMJPKFHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O3/c1-8-7-11(2,3)6-5-9(8)12(4,15)10(13)14/h8-9,15H,5-7H2,1-4H3,(H,13,14).
What are the key properties of 2-hydroxy-2-(2,4,4-trimethylcyclohexyl)propanoic acid?
2-hydroxy-2-(2,4,4-trimethylcyclohexyl)propanoic acid has a molecular weight of 214.30 g/mol, XLogP of 2.28, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-2-(2,4,4-trimethylcyclohexyl)propanoic acid is sourced from PubChem (CID 81313663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).