C15H28O2 — CID 81313760
2,4,4-trimethyl-1-(oxan-4-ylmethyl)cyclohexan-1-ol (PubChem CID 81313760) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is 2,4,4-trimethyl-1-(oxan-4-ylmethyl)cyclohexan-1-ol.
| Compound Name | 2,4,4-trimethyl-1-(oxan-4-ylmethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 81313760 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | 2,4,4-trimethyl-1-(oxan-4-ylmethyl)cyclohexan-1-ol |
| SMILES | CC1CC(C)(C)CCC1(O)CC1CCOCC1 |
| InChI | InChI=1S/C15H28O2/c1-12-10-14(2,3)6-7-15(12,16)11-13-4-8-17-9-5-13/h12-13,16H,4-11H2,1-3H3 |
| InChIKey | LYOSNNCVTCQKJA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |