About (1-anilino-2,4,4-trimethylcyclohexyl)methanol
(1-anilino-2,4,4-trimethylcyclohexyl)methanol (PubChem CID 81313938) has the molecular formula C16H25NO
and a molecular weight of 247.38 g/mol. Its IUPAC name is (1-anilino-2,4,4-trimethylcyclohexyl)methanol.
Molecular Properties
| Compound Name | (1-anilino-2,4,4-trimethylcyclohexyl)methanol |
| PubChem CID | 81313938 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | (1-anilino-2,4,4-trimethylcyclohexyl)methanol |
| SMILES | CC1CC(C)(C)CCC1(CO)Nc1ccccc1 |
| InChI | InChI=1S/C16H25NO/c1-13-11-15(2,3)9-10-16(13,12-18)17-14-7-5-4-6-8-14/h4-8,13,17-18H,9-12H2,1-3H3 |
| InChIKey | YGNQEDHQODCFGI-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1-anilino-2,4,4-trimethylcyclohexyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-anilino-2,4,4-trimethylcyclohexyl)methanol?
The IUPAC name of (1-anilino-2,4,4-trimethylcyclohexyl)methanol (CID 81313938) is (1-anilino-2,4,4-trimethylcyclohexyl)methanol.
What is the SMILES notation for (1-anilino-2,4,4-trimethylcyclohexyl)methanol?
The canonical SMILES for (1-anilino-2,4,4-trimethylcyclohexyl)methanol is CC1CC(C)(C)CCC1(CO)Nc1ccccc1.
What is the InChIKey of (1-anilino-2,4,4-trimethylcyclohexyl)methanol?
The InChIKey is YGNQEDHQODCFGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO/c1-13-11-15(2,3)9-10-16(13,12-18)17-14-7-5-4-6-8-14/h4-8,13,17-18H,9-12H2,1-3H3.
What are the key properties of (1-anilino-2,4,4-trimethylcyclohexyl)methanol?
(1-anilino-2,4,4-trimethylcyclohexyl)methanol has a molecular weight of 247.38 g/mol, XLogP of 3.68, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-anilino-2,4,4-trimethylcyclohexyl)methanol is sourced from PubChem (CID 81313938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).