C14H22N2O — CID 81314198
1-(4-amino-3-pyridinyl)-2,4,4-trimethylcyclohexan-1-ol (PubChem CID 81314198) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is 1-(4-amino-3-pyridinyl)-2,4,4-trimethylcyclohexan-1-ol.
| Compound Name | 1-(4-amino-3-pyridinyl)-2,4,4-trimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 81314198 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | 1-(4-amino-3-pyridinyl)-2,4,4-trimethylcyclohexan-1-ol |
| SMILES | CC1CC(C)(C)CCC1(O)c1cnccc1N |
| InChI | InChI=1S/C14H22N2O/c1-10-8-13(2,3)5-6-14(10,17)11-9-16-7-4-12(11)15/h4,7,9-10,17H,5-6,8H2,1-3H3,(H2,15,16) |
| InChIKey | JFMDVLFPWSYLKT-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |