C17H34O — CID 81314453
1-(2-ethylhexyl)-2,4,4-trimethylcyclohexan-1-ol (PubChem CID 81314453) has the molecular formula C17H34O and a molecular weight of 254.46 g/mol. Its IUPAC name is 1-(2-ethylhexyl)-2,4,4-trimethylcyclohexan-1-ol.
| Compound Name | 1-(2-ethylhexyl)-2,4,4-trimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 81314453 |
| Molecular Formula | C17H34O |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.26 |
| IUPAC Name | 1-(2-ethylhexyl)-2,4,4-trimethylcyclohexan-1-ol |
| SMILES | CCCCC(CC)CC1(O)CCC(C)(C)CC1C |
| InChI | InChI=1S/C17H34O/c1-6-8-9-15(7-2)13-17(18)11-10-16(4,5)12-14(17)3/h14-15,18H,6-13H2,1-5H3 |
| InChIKey | OQICAOHFHJGWFE-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |