C15H15FN2O — CID 81314531
N-(2-amino-6-fluorophenyl)-3,4-dimethylbenzamide (PubChem CID 81314531) has the molecular formula C15H15FN2O and a molecular weight of 258.30 g/mol. Its IUPAC name is N-(2-amino-6-fluorophenyl)-3,4-dimethylbenzamide.
| Compound Name | N-(2-amino-6-fluorophenyl)-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 81314531 |
| Molecular Formula | C15H15FN2O |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | N-(2-amino-6-fluorophenyl)-3,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2c(N)cccc2F)cc1C |
| InChI | InChI=1S/C15H15FN2O/c1-9-6-7-11(8-10(9)2)15(19)18-14-12(16)4-3-5-13(14)17/h3-8H,17H2,1-2H3,(H,18,19) |
| InChIKey | XJRJXUMPTZWABX-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|