C17H26O — CID 81314579
1-(2,4-dimethylphenyl)-2,4,4-trimethylcyclohexan-1-ol (PubChem CID 81314579) has the molecular formula C17H26O and a molecular weight of 246.39 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-2,4,4-trimethylcyclohexan-1-ol.
| Compound Name | 1-(2,4-dimethylphenyl)-2,4,4-trimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 81314579 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-2,4,4-trimethylcyclohexan-1-ol |
| SMILES | Cc1ccc(C2(O)CCC(C)(C)CC2C)c(C)c1 |
| InChI | InChI=1S/C17H26O/c1-12-6-7-15(13(2)10-12)17(18)9-8-16(4,5)11-14(17)3/h6-7,10,14,18H,8-9,11H2,1-5H3 |
| InChIKey | FFGHJPDONOQEHG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |