C18H29N3 — CID 81314851
[2-[2-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)ethyl]phenyl]methanamine (PubChem CID 81314851) has the molecular formula C18H29N3 and a molecular weight of 287.45 g/mol. Its IUPAC name is [2-[2-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)ethyl]phenyl]methanamine.
| Compound Name | [2-[2-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)ethyl]phenyl]methanamine |
|---|---|
| PubChem CID | 81314851 |
| Molecular Formula | C18H29N3 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.24 |
| IUPAC Name | [2-[2-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)ethyl]phenyl]methanamine |
| SMILES | CC1CN2CCCCC2CN1CCc1ccccc1CN |
| InChI | InChI=1S/C18H29N3/c1-15-13-21-10-5-4-8-18(21)14-20(15)11-9-16-6-2-3-7-17(16)12-19/h2-3,6-7,15,18H,4-5,8-14,19H2,1H3 |
| InChIKey | BRZGUPYHBYDYSZ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |