C18H25NO — CID 81315265
6,8,8-trimethyl-1-phenyl-2-azaspiro[4.5]decan-3-one (PubChem CID 81315265) has the molecular formula C18H25NO and a molecular weight of 271.40 g/mol. Its IUPAC name is 6,8,8-trimethyl-1-phenyl-2-azaspiro[4.5]decan-3-one.
| Compound Name | 6,8,8-trimethyl-1-phenyl-2-azaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 81315265 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | 6,8,8-trimethyl-1-phenyl-2-azaspiro[4.5]decan-3-one |
| SMILES | CC1CC(C)(C)CCC12CC(=O)NC2c1ccccc1 |
| InChI | InChI=1S/C18H25NO/c1-13-11-17(2,3)9-10-18(13)12-15(20)19-16(18)14-7-5-4-6-8-14/h4-8,13,16H,9-12H2,1-3H3,(H,19,20) |
| InChIKey | WHUREBLKNXLKGB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |