About N-propyl-N-(2,4,4-trimethylcyclohexyl)azetidin-3-amine
N-propyl-N-(2,4,4-trimethylcyclohexyl)azetidin-3-amine (PubChem CID 81315317) has the molecular formula C15H30N2
and a molecular weight of 238.42 g/mol. Its IUPAC name is N-propyl-N-(2,4,4-trimethylcyclohexyl)azetidin-3-amine.
Molecular Properties
| Compound Name | N-propyl-N-(2,4,4-trimethylcyclohexyl)azetidin-3-amine |
| PubChem CID | 81315317 |
| Molecular Formula | C15H30N2 |
| Molecular Weight | 238.42 g/mol |
| Exact Mass | 238.24 |
| IUPAC Name | N-propyl-N-(2,4,4-trimethylcyclohexyl)azetidin-3-amine |
| SMILES | CCCN(C1CNC1)C1CCC(C)(C)CC1C |
| InChI | InChI=1S/C15H30N2/c1-5-8-17(13-10-16-11-13)14-6-7-15(3,4)9-12(14)2/h12-14,16H,5-11H2,1-4H3 |
| InChIKey | QFKPVKSIAIEKPJ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.42 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-propyl-N-(2,4,4-trimethylcyclohexyl)azetidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propyl-N-(2,4,4-trimethylcyclohexyl)azetidin-3-amine?
The IUPAC name of N-propyl-N-(2,4,4-trimethylcyclohexyl)azetidin-3-amine (CID 81315317) is N-propyl-N-(2,4,4-trimethylcyclohexyl)azetidin-3-amine.
What is the SMILES notation for N-propyl-N-(2,4,4-trimethylcyclohexyl)azetidin-3-amine?
The canonical SMILES for N-propyl-N-(2,4,4-trimethylcyclohexyl)azetidin-3-amine is CCCN(C1CNC1)C1CCC(C)(C)CC1C.
What is the InChIKey of N-propyl-N-(2,4,4-trimethylcyclohexyl)azetidin-3-amine?
The InChIKey is QFKPVKSIAIEKPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30N2/c1-5-8-17(13-10-16-11-13)14-6-7-15(3,4)9-12(14)2/h12-14,16H,5-11H2,1-4H3.
What are the key properties of N-propyl-N-(2,4,4-trimethylcyclohexyl)azetidin-3-amine?
N-propyl-N-(2,4,4-trimethylcyclohexyl)azetidin-3-amine has a molecular weight of 238.42 g/mol, XLogP of 2.88, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-propyl-N-(2,4,4-trimethylcyclohexyl)azetidin-3-amine is sourced from PubChem (CID 81315317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).