C16H18BrFN2O — CID 81315335
N-[[6-[(3-bromo-5-fluorophenoxy)methyl]-3-pyridinyl]methyl]propan-1-amine (PubChem CID 81315335) has the molecular formula C16H18BrFN2O and a molecular weight of 353.24 g/mol. Its IUPAC name is N-[[6-[(3-bromo-5-fluorophenoxy)methyl]-3-pyridinyl]methyl]propan-1-amine.
| Compound Name | N-[[6-[(3-bromo-5-fluorophenoxy)methyl]-3-pyridinyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 81315335 |
| Molecular Formula | C16H18BrFN2O |
| Molecular Weight | 353.24 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | N-[[6-[(3-bromo-5-fluorophenoxy)methyl]-3-pyridinyl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccc(COc2cc(F)cc(Br)c2)nc1 |
| InChI | InChI=1S/C16H18BrFN2O/c1-2-5-19-9-12-3-4-15(20-10-12)11-21-16-7-13(17)6-14(18)8-16/h3-4,6-8,10,19H,2,5,9,11H2,1H3 |
| InChIKey | CATGREKZTIRJSY-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.24 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|