C17H13ClF2O — CID 81315390
1-(4-chlorobut-1-ynyl)-3-fluoro-5-[(2-fluorophenyl)methoxy]benzene (PubChem CID 81315390) has the molecular formula C17H13ClF2O and a molecular weight of 306.74 g/mol. Its IUPAC name is 1-(4-chlorobut-1-ynyl)-3-fluoro-5-[(2-fluorophenyl)methoxy]benzene.
| Compound Name | 1-(4-chlorobut-1-ynyl)-3-fluoro-5-[(2-fluorophenyl)methoxy]benzene |
|---|---|
| PubChem CID | 81315390 |
| Molecular Formula | C17H13ClF2O |
| Molecular Weight | 306.74 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 1-(4-chlorobut-1-ynyl)-3-fluoro-5-[(2-fluorophenyl)methoxy]benzene |
| SMILES | Fc1cc(C#CCCCl)cc(OCc2ccccc2F)c1 |
| InChI | InChI=1S/C17H13ClF2O/c18-8-4-3-5-13-9-15(19)11-16(10-13)21-12-14-6-1-2-7-17(14)20/h1-2,6-7,9-11H,4,8,12H2 |
| InChIKey | SSXDRAJTTPAJDQ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.74 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|