C15H20ClN3O2 — CID 81315811
1-(3-chloro-5-methylbenzoyl)-N,N-dimethylpiperazine-2-carboxamide (PubChem CID 81315811) has the molecular formula C15H20ClN3O2 and a molecular weight of 309.80 g/mol. Its IUPAC name is 1-(3-chloro-5-methylbenzoyl)-N,N-dimethylpiperazine-2-carboxamide.
| Compound Name | 1-(3-chloro-5-methylbenzoyl)-N,N-dimethylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 81315811 |
| Molecular Formula | C15H20ClN3O2 |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 1-(3-chloro-5-methylbenzoyl)-N,N-dimethylpiperazine-2-carboxamide |
| SMILES | Cc1cc(Cl)cc(C(=O)N2CCNCC2C(=O)N(C)C)c1 |
| InChI | InChI=1S/C15H20ClN3O2/c1-10-6-11(8-12(16)7-10)14(20)19-5-4-17-9-13(19)15(21)18(2)3/h6-8,13,17H,4-5,9H2,1-3H3 |
| InChIKey | XIJVLCRIYFQUPU-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |