C13H19N3O3 — CID 81317384
[1-(butan-2-ylamino)-1-oxopropan-2-yl] 5-aminopyridine-2-carboxylate (PubChem CID 81317384) has the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. Its IUPAC name is [1-(butan-2-ylamino)-1-oxopropan-2-yl] 5-aminopyridine-2-carboxylate.
| Compound Name | [1-(butan-2-ylamino)-1-oxopropan-2-yl] 5-aminopyridine-2-carboxylate |
|---|---|
| PubChem CID | 81317384 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | [1-(butan-2-ylamino)-1-oxopropan-2-yl] 5-aminopyridine-2-carboxylate |
| SMILES | CCC(C)NC(=O)C(C)OC(=O)c1ccc(N)cn1 |
| InChI | InChI=1S/C13H19N3O3/c1-4-8(2)16-12(17)9(3)19-13(18)11-6-5-10(14)7-15-11/h5-9H,4,14H2,1-3H3,(H,16,17) |
| InChIKey | DESLEEQKHGUEMP-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |