About [2-[(5,7-dimethyl-1,3-benzoxazol-2-yl)methyl]phenyl]methanamine
[2-[(5,7-dimethyl-1,3-benzoxazol-2-yl)methyl]phenyl]methanamine (PubChem CID 81317575) has the molecular formula C17H18N2O
and a molecular weight of 266.34 g/mol. Its IUPAC name is [2-[(5,7-dimethyl-1,3-benzoxazol-2-yl)methyl]phenyl]methanamine.
Molecular Properties
| Compound Name | [2-[(5,7-dimethyl-1,3-benzoxazol-2-yl)methyl]phenyl]methanamine |
| PubChem CID | 81317575 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | [2-[(5,7-dimethyl-1,3-benzoxazol-2-yl)methyl]phenyl]methanamine |
| SMILES | Cc1cc(C)c2oc(Cc3ccccc3CN)nc2c1 |
| InChI | InChI=1S/C17H18N2O/c1-11-7-12(2)17-15(8-11)19-16(20-17)9-13-5-3-4-6-14(13)10-18/h3-8H,9-10,18H2,1-2H3 |
| InChIKey | KQOKOOPUVLTLCU-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-[(5,7-dimethyl-1,3-benzoxazol-2-yl)methyl]phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(5,7-dimethyl-1,3-benzoxazol-2-yl)methyl]phenyl]methanamine?
The IUPAC name of [2-[(5,7-dimethyl-1,3-benzoxazol-2-yl)methyl]phenyl]methanamine (CID 81317575) is [2-[(5,7-dimethyl-1,3-benzoxazol-2-yl)methyl]phenyl]methanamine.
What is the SMILES notation for [2-[(5,7-dimethyl-1,3-benzoxazol-2-yl)methyl]phenyl]methanamine?
The canonical SMILES for [2-[(5,7-dimethyl-1,3-benzoxazol-2-yl)methyl]phenyl]methanamine is Cc1cc(C)c2oc(Cc3ccccc3CN)nc2c1.
What is the InChIKey of [2-[(5,7-dimethyl-1,3-benzoxazol-2-yl)methyl]phenyl]methanamine?
The InChIKey is KQOKOOPUVLTLCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2O/c1-11-7-12(2)17-15(8-11)19-16(20-17)9-13-5-3-4-6-14(13)10-18/h3-8H,9-10,18H2,1-2H3.
What are the key properties of [2-[(5,7-dimethyl-1,3-benzoxazol-2-yl)methyl]phenyl]methanamine?
[2-[(5,7-dimethyl-1,3-benzoxazol-2-yl)methyl]phenyl]methanamine has a molecular weight of 266.34 g/mol, XLogP of 3.49, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(5,7-dimethyl-1,3-benzoxazol-2-yl)methyl]phenyl]methanamine is sourced from PubChem (CID 81317575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).