About 1-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-6-(trifluoromethyl)pyridin-2-one
1-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-6-(trifluoromethyl)pyridin-2-one (PubChem CID 81318799) has the molecular formula C9H7F3N4OS
and a molecular weight of 276.24 g/mol. Its IUPAC name is 1-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-6-(trifluoromethyl)pyridin-2-one.
Molecular Properties
| Compound Name | 1-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-6-(trifluoromethyl)pyridin-2-one |
| PubChem CID | 81318799 |
| Molecular Formula | C9H7F3N4OS |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 1-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-6-(trifluoromethyl)pyridin-2-one |
| SMILES | Nc1nnc(Cn2c(C(F)(F)F)cccc2=O)s1 |
| InChI | InChI=1S/C9H7F3N4OS/c10-9(11,12)5-2-1-3-7(17)16(5)4-6-14-15-8(13)18-6/h1-3H,4H2,(H2,13,15) |
| InChIKey | ZGWURHJYRATYAV-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-6-(trifluoromethyl)pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-6-(trifluoromethyl)pyridin-2-one?
The IUPAC name of 1-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-6-(trifluoromethyl)pyridin-2-one (CID 81318799) is 1-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-6-(trifluoromethyl)pyridin-2-one.
What is the SMILES notation for 1-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-6-(trifluoromethyl)pyridin-2-one?
The canonical SMILES for 1-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-6-(trifluoromethyl)pyridin-2-one is Nc1nnc(Cn2c(C(F)(F)F)cccc2=O)s1.
What is the InChIKey of 1-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-6-(trifluoromethyl)pyridin-2-one?
The InChIKey is ZGWURHJYRATYAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7F3N4OS/c10-9(11,12)5-2-1-3-7(17)16(5)4-6-14-15-8(13)18-6/h1-3H,4H2,(H2,13,15).
What are the key properties of 1-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-6-(trifluoromethyl)pyridin-2-one?
1-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-6-(trifluoromethyl)pyridin-2-one has a molecular weight of 276.24 g/mol, XLogP of 1.35, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-6-(trifluoromethyl)pyridin-2-one is sourced from PubChem (CID 81318799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).