C9H9ClN2O3S — CID 81319842
2-(5-methyl-2-pyridinyl)-4-oxoazetidine-1-sulfonyl chloride (PubChem CID 81319842) has the molecular formula C9H9ClN2O3S and a molecular weight of 260.70 g/mol. Its IUPAC name is 2-(5-methyl-2-pyridinyl)-4-oxoazetidine-1-sulfonyl chloride.
| Compound Name | 2-(5-methyl-2-pyridinyl)-4-oxoazetidine-1-sulfonyl chloride |
|---|---|
| PubChem CID | 81319842 |
| Molecular Formula | C9H9ClN2O3S |
| Molecular Weight | 260.70 g/mol |
| Exact Mass | 260.00 |
| IUPAC Name | 2-(5-methyl-2-pyridinyl)-4-oxoazetidine-1-sulfonyl chloride |
| SMILES | Cc1ccc(C2CC(=O)N2S(=O)(=O)Cl)nc1 |
| InChI | InChI=1S/C9H9ClN2O3S/c1-6-2-3-7(11-5-6)8-4-9(13)12(8)16(10,14)15/h2-3,5,8H,4H2,1H3 |
| InChIKey | AGHYEXRRFQMTKZ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.70 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |