About 1-(5-amino-4,4-dimethylpentyl)-6-(trifluoromethyl)pyridin-2-one
1-(5-amino-4,4-dimethylpentyl)-6-(trifluoromethyl)pyridin-2-one (PubChem CID 81320195) has the molecular formula C13H19F3N2O
and a molecular weight of 276.30 g/mol. Its IUPAC name is 1-(5-amino-4,4-dimethylpentyl)-6-(trifluoromethyl)pyridin-2-one.
Molecular Properties
| Compound Name | 1-(5-amino-4,4-dimethylpentyl)-6-(trifluoromethyl)pyridin-2-one |
| PubChem CID | 81320195 |
| Molecular Formula | C13H19F3N2O |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 1-(5-amino-4,4-dimethylpentyl)-6-(trifluoromethyl)pyridin-2-one |
| SMILES | CC(C)(CN)CCCn1c(C(F)(F)F)cccc1=O |
| InChI | InChI=1S/C13H19F3N2O/c1-12(2,9-17)7-4-8-18-10(13(14,15)16)5-3-6-11(18)19/h3,5-6H,4,7-9,17H2,1-2H3 |
| InChIKey | BNTAJLGFJUCXSP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(5-amino-4,4-dimethylpentyl)-6-(trifluoromethyl)pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-amino-4,4-dimethylpentyl)-6-(trifluoromethyl)pyridin-2-one?
The IUPAC name of 1-(5-amino-4,4-dimethylpentyl)-6-(trifluoromethyl)pyridin-2-one (CID 81320195) is 1-(5-amino-4,4-dimethylpentyl)-6-(trifluoromethyl)pyridin-2-one.
What is the SMILES notation for 1-(5-amino-4,4-dimethylpentyl)-6-(trifluoromethyl)pyridin-2-one?
The canonical SMILES for 1-(5-amino-4,4-dimethylpentyl)-6-(trifluoromethyl)pyridin-2-one is CC(C)(CN)CCCn1c(C(F)(F)F)cccc1=O.
What is the InChIKey of 1-(5-amino-4,4-dimethylpentyl)-6-(trifluoromethyl)pyridin-2-one?
The InChIKey is BNTAJLGFJUCXSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19F3N2O/c1-12(2,9-17)7-4-8-18-10(13(14,15)16)5-3-6-11(18)19/h3,5-6H,4,7-9,17H2,1-2H3.
What are the key properties of 1-(5-amino-4,4-dimethylpentyl)-6-(trifluoromethyl)pyridin-2-one?
1-(5-amino-4,4-dimethylpentyl)-6-(trifluoromethyl)pyridin-2-one has a molecular weight of 276.30 g/mol, XLogP of 2.63, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-amino-4,4-dimethylpentyl)-6-(trifluoromethyl)pyridin-2-one is sourced from PubChem (CID 81320195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).