About 2-[(2,4,4-trimethylcyclohexyl)amino]ethanesulfonamide
2-[(2,4,4-trimethylcyclohexyl)amino]ethanesulfonamide (PubChem CID 81320465) has the molecular formula C11H24N2O2S
and a molecular weight of 248.39 g/mol. Its IUPAC name is 2-[(2,4,4-trimethylcyclohexyl)amino]ethanesulfonamide.
Molecular Properties
| Compound Name | 2-[(2,4,4-trimethylcyclohexyl)amino]ethanesulfonamide |
| PubChem CID | 81320465 |
| Molecular Formula | C11H24N2O2S |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 2-[(2,4,4-trimethylcyclohexyl)amino]ethanesulfonamide |
| SMILES | CC1CC(C)(C)CCC1NCCS(N)(=O)=O |
| InChI | InChI=1S/C11H24N2O2S/c1-9-8-11(2,3)5-4-10(9)13-6-7-16(12,14)15/h9-10,13H,4-8H2,1-3H3,(H2,12,14,15) |
| InChIKey | MUIJEFLRSKHMQO-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(2,4,4-trimethylcyclohexyl)amino]ethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,4,4-trimethylcyclohexyl)amino]ethanesulfonamide?
The IUPAC name of 2-[(2,4,4-trimethylcyclohexyl)amino]ethanesulfonamide (CID 81320465) is 2-[(2,4,4-trimethylcyclohexyl)amino]ethanesulfonamide.
What is the SMILES notation for 2-[(2,4,4-trimethylcyclohexyl)amino]ethanesulfonamide?
The canonical SMILES for 2-[(2,4,4-trimethylcyclohexyl)amino]ethanesulfonamide is CC1CC(C)(C)CCC1NCCS(N)(=O)=O.
What is the InChIKey of 2-[(2,4,4-trimethylcyclohexyl)amino]ethanesulfonamide?
The InChIKey is MUIJEFLRSKHMQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N2O2S/c1-9-8-11(2,3)5-4-10(9)13-6-7-16(12,14)15/h9-10,13H,4-8H2,1-3H3,(H2,12,14,15).
What are the key properties of 2-[(2,4,4-trimethylcyclohexyl)amino]ethanesulfonamide?
2-[(2,4,4-trimethylcyclohexyl)amino]ethanesulfonamide has a molecular weight of 248.39 g/mol, XLogP of 1.08, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,4,4-trimethylcyclohexyl)amino]ethanesulfonamide is sourced from PubChem (CID 81320465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).