C11H18N2O2 — CID 81320656
6,8,8-trimethyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 81320656) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 6,8,8-trimethyl-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 6,8,8-trimethyl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 81320656 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 6,8,8-trimethyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CC1CC(C)(C)CCC12NC(=O)NC2=O |
| InChI | InChI=1S/C11H18N2O2/c1-7-6-10(2,3)4-5-11(7)8(14)12-9(15)13-11/h7H,4-6H2,1-3H3,(H2,12,13,14,15) |
| InChIKey | KQIDBOFIQZLMFI-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|