C15H27N5 — CID 81320825
[1-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-2,4,4-trimethylcyclohexyl]methanamine (PubChem CID 81320825) has the molecular formula C15H27N5 and a molecular weight of 277.42 g/mol. Its IUPAC name is [1-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-2,4,4-trimethylcyclohexyl]methanamine.
| Compound Name | [1-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-2,4,4-trimethylcyclohexyl]methanamine |
|---|---|
| PubChem CID | 81320825 |
| Molecular Formula | C15H27N5 |
| Molecular Weight | 277.42 g/mol |
| Exact Mass | 277.23 |
| IUPAC Name | [1-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-2,4,4-trimethylcyclohexyl]methanamine |
| SMILES | CC1CC(C)(C)CCC1(CN)N1CCn2cnnc2C1 |
| InChI | InChI=1S/C15H27N5/c1-12-8-14(2,3)4-5-15(12,10-16)20-7-6-19-11-17-18-13(19)9-20/h11-12H,4-10,16H2,1-3H3 |
| InChIKey | HELZSNITRBNKMR-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.42 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |