C10H12ClN3O2 — CID 81325204
N-[(2Z)-2-amino-2-hydroxyiminoethyl]-3-chloro-5-methylbenzamide (PubChem CID 81325204) has the molecular formula C10H12ClN3O2 and a molecular weight of 241.68 g/mol. Its IUPAC name is N-[(2Z)-2-amino-2-hydroxyiminoethyl]-3-chloro-5-methylbenzamide.
| Compound Name | N-[(2Z)-2-amino-2-hydroxyiminoethyl]-3-chloro-5-methylbenzamide |
|---|---|
| PubChem CID | 81325204 |
| Molecular Formula | C10H12ClN3O2 |
| Molecular Weight | 241.68 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | N-[(2Z)-2-amino-2-hydroxyiminoethyl]-3-chloro-5-methylbenzamide |
| SMILES | Cc1cc(Cl)cc(C(=O)NC/C(N)=N/O)c1 |
| InChI | InChI=1S/C10H12ClN3O2/c1-6-2-7(4-8(11)3-6)10(15)13-5-9(12)14-16/h2-4,16H,5H2,1H3,(H2,12,14)(H,13,15) |
| InChIKey | WYJXMXZTYHEPQZ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.68 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|