About 3-[3-fluoro-5-(2,2,2-trifluoroethoxy)phenyl]prop-2-yn-1-amine
3-[3-fluoro-5-(2,2,2-trifluoroethoxy)phenyl]prop-2-yn-1-amine (PubChem CID 81325837) has the molecular formula C11H9F4NO
and a molecular weight of 247.19 g/mol. Its IUPAC name is 3-[3-fluoro-5-(2,2,2-trifluoroethoxy)phenyl]prop-2-yn-1-amine.
Molecular Properties
| Compound Name | 3-[3-fluoro-5-(2,2,2-trifluoroethoxy)phenyl]prop-2-yn-1-amine |
| PubChem CID | 81325837 |
| Molecular Formula | C11H9F4NO |
| Molecular Weight | 247.19 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 3-[3-fluoro-5-(2,2,2-trifluoroethoxy)phenyl]prop-2-yn-1-amine |
| SMILES | NCC#Cc1cc(F)cc(OCC(F)(F)F)c1 |
| InChI | InChI=1S/C11H9F4NO/c12-9-4-8(2-1-3-16)5-10(6-9)17-7-11(13,14)15/h4-6H,3,7,16H2 |
| InChIKey | YAEIDKZFDHOODM-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.19 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-fluoro-5-(2,2,2-trifluoroethoxy)phenyl]prop-2-yn-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-fluoro-5-(2,2,2-trifluoroethoxy)phenyl]prop-2-yn-1-amine?
The IUPAC name of 3-[3-fluoro-5-(2,2,2-trifluoroethoxy)phenyl]prop-2-yn-1-amine (CID 81325837) is 3-[3-fluoro-5-(2,2,2-trifluoroethoxy)phenyl]prop-2-yn-1-amine.
What is the SMILES notation for 3-[3-fluoro-5-(2,2,2-trifluoroethoxy)phenyl]prop-2-yn-1-amine?
The canonical SMILES for 3-[3-fluoro-5-(2,2,2-trifluoroethoxy)phenyl]prop-2-yn-1-amine is NCC#Cc1cc(F)cc(OCC(F)(F)F)c1.
What is the InChIKey of 3-[3-fluoro-5-(2,2,2-trifluoroethoxy)phenyl]prop-2-yn-1-amine?
The InChIKey is YAEIDKZFDHOODM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9F4NO/c12-9-4-8(2-1-3-16)5-10(6-9)17-7-11(13,14)15/h4-6H,3,7,16H2.
What are the key properties of 3-[3-fluoro-5-(2,2,2-trifluoroethoxy)phenyl]prop-2-yn-1-amine?
3-[3-fluoro-5-(2,2,2-trifluoroethoxy)phenyl]prop-2-yn-1-amine has a molecular weight of 247.19 g/mol, XLogP of 2.08, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-fluoro-5-(2,2,2-trifluoroethoxy)phenyl]prop-2-yn-1-amine is sourced from PubChem (CID 81325837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).