About 2-[chloro-(2,5-dimethylthiophen-3-yl)methyl]-5-methyloxolane
2-[chloro-(2,5-dimethylthiophen-3-yl)methyl]-5-methyloxolane (PubChem CID 81326844) has the molecular formula C12H17ClOS
and a molecular weight of 244.79 g/mol. Its IUPAC name is 2-[chloro-(2,5-dimethylthiophen-3-yl)methyl]-5-methyloxolane.
Molecular Properties
| Compound Name | 2-[chloro-(2,5-dimethylthiophen-3-yl)methyl]-5-methyloxolane |
| PubChem CID | 81326844 |
| Molecular Formula | C12H17ClOS |
| Molecular Weight | 244.79 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 2-[chloro-(2,5-dimethylthiophen-3-yl)methyl]-5-methyloxolane |
| SMILES | Cc1cc(C(Cl)C2CCC(C)O2)c(C)s1 |
| InChI | InChI=1S/C12H17ClOS/c1-7-4-5-11(14-7)12(13)10-6-8(2)15-9(10)3/h6-7,11-12H,4-5H2,1-3H3 |
| InChIKey | IGLUPNRKDJQATR-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.79 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[chloro-(2,5-dimethylthiophen-3-yl)methyl]-5-methyloxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[chloro-(2,5-dimethylthiophen-3-yl)methyl]-5-methyloxolane?
The IUPAC name of 2-[chloro-(2,5-dimethylthiophen-3-yl)methyl]-5-methyloxolane (CID 81326844) is 2-[chloro-(2,5-dimethylthiophen-3-yl)methyl]-5-methyloxolane.
What is the SMILES notation for 2-[chloro-(2,5-dimethylthiophen-3-yl)methyl]-5-methyloxolane?
The canonical SMILES for 2-[chloro-(2,5-dimethylthiophen-3-yl)methyl]-5-methyloxolane is Cc1cc(C(Cl)C2CCC(C)O2)c(C)s1.
What is the InChIKey of 2-[chloro-(2,5-dimethylthiophen-3-yl)methyl]-5-methyloxolane?
The InChIKey is IGLUPNRKDJQATR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17ClOS/c1-7-4-5-11(14-7)12(13)10-6-8(2)15-9(10)3/h6-7,11-12H,4-5H2,1-3H3.
What are the key properties of 2-[chloro-(2,5-dimethylthiophen-3-yl)methyl]-5-methyloxolane?
2-[chloro-(2,5-dimethylthiophen-3-yl)methyl]-5-methyloxolane has a molecular weight of 244.79 g/mol, XLogP of 4.21, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[chloro-(2,5-dimethylthiophen-3-yl)methyl]-5-methyloxolane is sourced from PubChem (CID 81326844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).