About 2-[(4-bromo-2,5-difluorophenyl)-chloromethyl]-5-methyloxolane
2-[(4-bromo-2,5-difluorophenyl)-chloromethyl]-5-methyloxolane (PubChem CID 81327614) has the molecular formula C12H12BrClF2O
and a molecular weight of 325.58 g/mol. Its IUPAC name is 2-[(4-bromo-2,5-difluorophenyl)-chloromethyl]-5-methyloxolane.
Molecular Properties
| Compound Name | 2-[(4-bromo-2,5-difluorophenyl)-chloromethyl]-5-methyloxolane |
| PubChem CID | 81327614 |
| Molecular Formula | C12H12BrClF2O |
| Molecular Weight | 325.58 g/mol |
| Exact Mass | 323.97 |
| IUPAC Name | 2-[(4-bromo-2,5-difluorophenyl)-chloromethyl]-5-methyloxolane |
| SMILES | CC1CCC(C(Cl)c2cc(F)c(Br)cc2F)O1 |
| InChI | InChI=1S/C12H12BrClF2O/c1-6-2-3-11(17-6)12(14)7-4-10(16)8(13)5-9(7)15/h4-6,11-12H,2-3H2,1H3 |
| InChIKey | FPJRZCYTOVNFBU-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.58 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4-bromo-2,5-difluorophenyl)-chloromethyl]-5-methyloxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-bromo-2,5-difluorophenyl)-chloromethyl]-5-methyloxolane?
The IUPAC name of 2-[(4-bromo-2,5-difluorophenyl)-chloromethyl]-5-methyloxolane (CID 81327614) is 2-[(4-bromo-2,5-difluorophenyl)-chloromethyl]-5-methyloxolane.
What is the SMILES notation for 2-[(4-bromo-2,5-difluorophenyl)-chloromethyl]-5-methyloxolane?
The canonical SMILES for 2-[(4-bromo-2,5-difluorophenyl)-chloromethyl]-5-methyloxolane is CC1CCC(C(Cl)c2cc(F)c(Br)cc2F)O1.
What is the InChIKey of 2-[(4-bromo-2,5-difluorophenyl)-chloromethyl]-5-methyloxolane?
The InChIKey is FPJRZCYTOVNFBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12BrClF2O/c1-6-2-3-11(17-6)12(14)7-4-10(16)8(13)5-9(7)15/h4-6,11-12H,2-3H2,1H3.
What are the key properties of 2-[(4-bromo-2,5-difluorophenyl)-chloromethyl]-5-methyloxolane?
2-[(4-bromo-2,5-difluorophenyl)-chloromethyl]-5-methyloxolane has a molecular weight of 325.58 g/mol, XLogP of 4.57, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-bromo-2,5-difluorophenyl)-chloromethyl]-5-methyloxolane is sourced from PubChem (CID 81327614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).