C17H27NOS — CID 81328026
[2-(4-tert-butylphenyl)sulfinylcyclohexyl]methanamine (PubChem CID 81328026) has the molecular formula C17H27NOS and a molecular weight of 293.48 g/mol. Its IUPAC name is [2-(4-tert-butylphenyl)sulfinylcyclohexyl]methanamine.
| Compound Name | [2-(4-tert-butylphenyl)sulfinylcyclohexyl]methanamine |
|---|---|
| PubChem CID | 81328026 |
| Molecular Formula | C17H27NOS |
| Molecular Weight | 293.48 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | [2-(4-tert-butylphenyl)sulfinylcyclohexyl]methanamine |
| SMILES | CC(C)(C)c1ccc(S(=O)C2CCCCC2CN)cc1 |
| InChI | InChI=1S/C17H27NOS/c1-17(2,3)14-8-10-15(11-9-14)20(19)16-7-5-4-6-13(16)12-18/h8-11,13,16H,4-7,12,18H2,1-3H3 |
| InChIKey | DVTFNDRIDQQLIY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.48 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |