About 5-(2,5-difluorophenyl)sulfinylpentan-1-amine
5-(2,5-difluorophenyl)sulfinylpentan-1-amine (PubChem CID 81328148) has the molecular formula C11H15F2NOS
and a molecular weight of 247.31 g/mol. Its IUPAC name is 5-(2,5-difluorophenyl)sulfinylpentan-1-amine.
Molecular Properties
| Compound Name | 5-(2,5-difluorophenyl)sulfinylpentan-1-amine |
| PubChem CID | 81328148 |
| Molecular Formula | C11H15F2NOS |
| Molecular Weight | 247.31 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 5-(2,5-difluorophenyl)sulfinylpentan-1-amine |
| SMILES | NCCCCCS(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C11H15F2NOS/c12-9-4-5-10(13)11(8-9)16(15)7-3-1-2-6-14/h4-5,8H,1-3,6-7,14H2 |
| InChIKey | XKIFNKAAXJOZBI-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.31 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,5-difluorophenyl)sulfinylpentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,5-difluorophenyl)sulfinylpentan-1-amine?
The IUPAC name of 5-(2,5-difluorophenyl)sulfinylpentan-1-amine (CID 81328148) is 5-(2,5-difluorophenyl)sulfinylpentan-1-amine.
What is the SMILES notation for 5-(2,5-difluorophenyl)sulfinylpentan-1-amine?
The canonical SMILES for 5-(2,5-difluorophenyl)sulfinylpentan-1-amine is NCCCCCS(=O)c1cc(F)ccc1F.
What is the InChIKey of 5-(2,5-difluorophenyl)sulfinylpentan-1-amine?
The InChIKey is XKIFNKAAXJOZBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15F2NOS/c12-9-4-5-10(13)11(8-9)16(15)7-3-1-2-6-14/h4-5,8H,1-3,6-7,14H2.
What are the key properties of 5-(2,5-difluorophenyl)sulfinylpentan-1-amine?
5-(2,5-difluorophenyl)sulfinylpentan-1-amine has a molecular weight of 247.31 g/mol, XLogP of 2.20, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,5-difluorophenyl)sulfinylpentan-1-amine is sourced from PubChem (CID 81328148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).