About 3-butan-2-ylsulfinyl-4,4,4-trifluorobutan-1-amine
3-butan-2-ylsulfinyl-4,4,4-trifluorobutan-1-amine (PubChem CID 81328732) has the molecular formula C8H16F3NOS
and a molecular weight of 231.28 g/mol. Its IUPAC name is 3-butan-2-ylsulfinyl-4,4,4-trifluorobutan-1-amine.
Molecular Properties
| Compound Name | 3-butan-2-ylsulfinyl-4,4,4-trifluorobutan-1-amine |
| PubChem CID | 81328732 |
| Molecular Formula | C8H16F3NOS |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 3-butan-2-ylsulfinyl-4,4,4-trifluorobutan-1-amine |
| SMILES | CCC(C)S(=O)C(CCN)C(F)(F)F |
| InChI | InChI=1S/C8H16F3NOS/c1-3-6(2)14(13)7(4-5-12)8(9,10)11/h6-7H,3-5,12H2,1-2H3 |
| InChIKey | CPLLNDGQHMHRNH-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-butan-2-ylsulfinyl-4,4,4-trifluorobutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butan-2-ylsulfinyl-4,4,4-trifluorobutan-1-amine?
The IUPAC name of 3-butan-2-ylsulfinyl-4,4,4-trifluorobutan-1-amine (CID 81328732) is 3-butan-2-ylsulfinyl-4,4,4-trifluorobutan-1-amine.
What is the SMILES notation for 3-butan-2-ylsulfinyl-4,4,4-trifluorobutan-1-amine?
The canonical SMILES for 3-butan-2-ylsulfinyl-4,4,4-trifluorobutan-1-amine is CCC(C)S(=O)C(CCN)C(F)(F)F.
What is the InChIKey of 3-butan-2-ylsulfinyl-4,4,4-trifluorobutan-1-amine?
The InChIKey is CPLLNDGQHMHRNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16F3NOS/c1-3-6(2)14(13)7(4-5-12)8(9,10)11/h6-7H,3-5,12H2,1-2H3.
What are the key properties of 3-butan-2-ylsulfinyl-4,4,4-trifluorobutan-1-amine?
3-butan-2-ylsulfinyl-4,4,4-trifluorobutan-1-amine has a molecular weight of 231.28 g/mol, XLogP of 1.81, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butan-2-ylsulfinyl-4,4,4-trifluorobutan-1-amine is sourced from PubChem (CID 81328732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).