C13H17BrO3 — CID 81330381
(3-bromo-4-methoxyphenyl)-(5-methyloxolan-2-yl)methanol (PubChem CID 81330381) has the molecular formula C13H17BrO3 and a molecular weight of 301.18 g/mol. Its IUPAC name is (3-bromo-4-methoxyphenyl)-(5-methyloxolan-2-yl)methanol.
| Compound Name | (3-bromo-4-methoxyphenyl)-(5-methyloxolan-2-yl)methanol |
|---|---|
| PubChem CID | 81330381 |
| Molecular Formula | C13H17BrO3 |
| Molecular Weight | 301.18 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | (3-bromo-4-methoxyphenyl)-(5-methyloxolan-2-yl)methanol |
| SMILES | COc1ccc(C(O)C2CCC(C)O2)cc1Br |
| InChI | InChI=1S/C13H17BrO3/c1-8-3-5-12(17-8)13(15)9-4-6-11(16-2)10(14)7-9/h4,6-8,12-13,15H,3,5H2,1-2H3 |
| InChIKey | DCGBFWFIICIURO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.18 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |