C15H15F2NO3 — CID 81330451
2-[4-(difluoromethoxy)phenyl]-3-(5-methyloxolan-2-yl)-3-oxopropanenitrile (PubChem CID 81330451) has the molecular formula C15H15F2NO3 and a molecular weight of 295.29 g/mol. Its IUPAC name is 2-[4-(difluoromethoxy)phenyl]-3-(5-methyloxolan-2-yl)-3-oxopropanenitrile.
| Compound Name | 2-[4-(difluoromethoxy)phenyl]-3-(5-methyloxolan-2-yl)-3-oxopropanenitrile |
|---|---|
| PubChem CID | 81330451 |
| Molecular Formula | C15H15F2NO3 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 2-[4-(difluoromethoxy)phenyl]-3-(5-methyloxolan-2-yl)-3-oxopropanenitrile |
| SMILES | CC1CCC(C(=O)C(C#N)c2ccc(OC(F)F)cc2)O1 |
| InChI | InChI=1S/C15H15F2NO3/c1-9-2-7-13(20-9)14(19)12(8-18)10-3-5-11(6-4-10)21-15(16)17/h3-6,9,12-13,15H,2,7H2,1H3 |
| InChIKey | YKTHIRUNTIJUCH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |