About 4-methyl-3-(3,3,3-trifluoropropyl)-1H-imidazole-2-thione
4-methyl-3-(3,3,3-trifluoropropyl)-1H-imidazole-2-thione (PubChem CID 81334629) has the molecular formula C7H9F3N2S
and a molecular weight of 210.22 g/mol. Its IUPAC name is 4-methyl-3-(3,3,3-trifluoropropyl)-1H-imidazole-2-thione.
Molecular Properties
| Compound Name | 4-methyl-3-(3,3,3-trifluoropropyl)-1H-imidazole-2-thione |
| PubChem CID | 81334629 |
| Molecular Formula | C7H9F3N2S |
| Molecular Weight | 210.22 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | 4-methyl-3-(3,3,3-trifluoropropyl)-1H-imidazole-2-thione |
| SMILES | Cc1c[nH]c(=S)n1CCC(F)(F)F |
| InChI | InChI=1S/C7H9F3N2S/c1-5-4-11-6(13)12(5)3-2-7(8,9)10/h4H,2-3H2,1H3,(H,11,13) |
| InChIKey | ONZXXOOKCLZZKI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.22 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-3-(3,3,3-trifluoropropyl)-1H-imidazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3-(3,3,3-trifluoropropyl)-1H-imidazole-2-thione?
The IUPAC name of 4-methyl-3-(3,3,3-trifluoropropyl)-1H-imidazole-2-thione (CID 81334629) is 4-methyl-3-(3,3,3-trifluoropropyl)-1H-imidazole-2-thione.
What is the SMILES notation for 4-methyl-3-(3,3,3-trifluoropropyl)-1H-imidazole-2-thione?
The canonical SMILES for 4-methyl-3-(3,3,3-trifluoropropyl)-1H-imidazole-2-thione is Cc1c[nH]c(=S)n1CCC(F)(F)F.
What is the InChIKey of 4-methyl-3-(3,3,3-trifluoropropyl)-1H-imidazole-2-thione?
The InChIKey is ONZXXOOKCLZZKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9F3N2S/c1-5-4-11-6(13)12(5)3-2-7(8,9)10/h4H,2-3H2,1H3,(H,11,13).
What are the key properties of 4-methyl-3-(3,3,3-trifluoropropyl)-1H-imidazole-2-thione?
4-methyl-3-(3,3,3-trifluoropropyl)-1H-imidazole-2-thione has a molecular weight of 210.22 g/mol, XLogP of 2.81, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3-(3,3,3-trifluoropropyl)-1H-imidazole-2-thione is sourced from PubChem (CID 81334629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).