About 5-methyl-3-(2,2,2-trifluoroethyl)-1H-imidazole-2-thione
5-methyl-3-(2,2,2-trifluoroethyl)-1H-imidazole-2-thione (PubChem CID 81334660) has the molecular formula C6H7F3N2S
and a molecular weight of 196.20 g/mol. Its IUPAC name is 5-methyl-3-(2,2,2-trifluoroethyl)-1H-imidazole-2-thione.
Molecular Properties
| Compound Name | 5-methyl-3-(2,2,2-trifluoroethyl)-1H-imidazole-2-thione |
| PubChem CID | 81334660 |
| Molecular Formula | C6H7F3N2S |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.03 |
| IUPAC Name | 5-methyl-3-(2,2,2-trifluoroethyl)-1H-imidazole-2-thione |
| SMILES | Cc1cn(CC(F)(F)F)c(=S)[nH]1 |
| InChI | InChI=1S/C6H7F3N2S/c1-4-2-11(5(12)10-4)3-6(7,8)9/h2H,3H2,1H3,(H,10,12) |
| InChIKey | MIYSOBMOBALBMG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-3-(2,2,2-trifluoroethyl)-1H-imidazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-3-(2,2,2-trifluoroethyl)-1H-imidazole-2-thione?
The IUPAC name of 5-methyl-3-(2,2,2-trifluoroethyl)-1H-imidazole-2-thione (CID 81334660) is 5-methyl-3-(2,2,2-trifluoroethyl)-1H-imidazole-2-thione.
What is the SMILES notation for 5-methyl-3-(2,2,2-trifluoroethyl)-1H-imidazole-2-thione?
The canonical SMILES for 5-methyl-3-(2,2,2-trifluoroethyl)-1H-imidazole-2-thione is Cc1cn(CC(F)(F)F)c(=S)[nH]1.
What is the InChIKey of 5-methyl-3-(2,2,2-trifluoroethyl)-1H-imidazole-2-thione?
The InChIKey is MIYSOBMOBALBMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7F3N2S/c1-4-2-11(5(12)10-4)3-6(7,8)9/h2H,3H2,1H3,(H,10,12).
What are the key properties of 5-methyl-3-(2,2,2-trifluoroethyl)-1H-imidazole-2-thione?
5-methyl-3-(2,2,2-trifluoroethyl)-1H-imidazole-2-thione has a molecular weight of 196.20 g/mol, XLogP of 2.42, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3-(2,2,2-trifluoroethyl)-1H-imidazole-2-thione is sourced from PubChem (CID 81334660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).