C10H6Cl2N4S2 — CID 81335162
3-(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)-5-methyl-1H-imidazole-2-thione (PubChem CID 81335162) has the molecular formula C10H6Cl2N4S2 and a molecular weight of 317.23 g/mol. Its IUPAC name is 3-(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)-5-methyl-1H-imidazole-2-thione.
| Compound Name | 3-(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)-5-methyl-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 81335162 |
| Molecular Formula | C10H6Cl2N4S2 |
| Molecular Weight | 317.23 g/mol |
| Exact Mass | 315.94 |
| IUPAC Name | 3-(3,5-dichloro-8λ4-thia-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)-5-methyl-1H-imidazole-2-thione |
| SMILES | Cc1cn(-c2c(Cl)cc(Cl)c3c2N=S=N3)c(=S)[nH]1 |
| InChI | InChI=1S/C10H6Cl2N4S2/c1-4-3-16(10(17)13-4)9-6(12)2-5(11)7-8(9)15-18-14-7/h2-3H,1H3,(H,13,17) |
| InChIKey | IHGNSWPLFATYKH-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 45.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.23 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|