C15H25N3OS — CID 81335237
3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-4-tert-butyl-1H-imidazole-2-thione (PubChem CID 81335237) has the molecular formula C15H25N3OS and a molecular weight of 295.45 g/mol. Its IUPAC name is 3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-4-tert-butyl-1H-imidazole-2-thione.
| Compound Name | 3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-4-tert-butyl-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 81335237 |
| Molecular Formula | C15H25N3OS |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | 3-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-4-tert-butyl-1H-imidazole-2-thione |
| SMILES | CC(C)(C)c1c[nH]c(=S)n1CC1CN2CCCC2CO1 |
| InChI | InChI=1S/C15H25N3OS/c1-15(2,3)13-7-16-14(20)18(13)9-12-8-17-6-4-5-11(17)10-19-12/h7,11-12H,4-6,8-10H2,1-3H3,(H,16,20) |
| InChIKey | WVUZHBULIAYLJL-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 33.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|