C9H14N2S — CID 81335639
3-(cyclobutylmethyl)-4-methyl-1H-imidazole-2-thione (PubChem CID 81335639) has the molecular formula C9H14N2S and a molecular weight of 182.29 g/mol. Its IUPAC name is 3-(cyclobutylmethyl)-4-methyl-1H-imidazole-2-thione.
| Compound Name | 3-(cyclobutylmethyl)-4-methyl-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 81335639 |
| Molecular Formula | C9H14N2S |
| Molecular Weight | 182.29 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 3-(cyclobutylmethyl)-4-methyl-1H-imidazole-2-thione |
| SMILES | Cc1c[nH]c(=S)n1CC1CCC1 |
| InChI | InChI=1S/C9H14N2S/c1-7-5-10-9(12)11(7)6-8-3-2-4-8/h5,8H,2-4,6H2,1H3,(H,10,12) |
| InChIKey | JQHQWNKYOVCWCK-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.29 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|