C9H15N3OS — CID 81335845
2-(5-methyl-2-sulfanylidene-1H-imidazol-3-yl)-N-propan-2-ylacetamide (PubChem CID 81335845) has the molecular formula C9H15N3OS and a molecular weight of 213.31 g/mol. Its IUPAC name is 2-(5-methyl-2-sulfanylidene-1H-imidazol-3-yl)-N-propan-2-ylacetamide.
| Compound Name | 2-(5-methyl-2-sulfanylidene-1H-imidazol-3-yl)-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 81335845 |
| Molecular Formula | C9H15N3OS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 2-(5-methyl-2-sulfanylidene-1H-imidazol-3-yl)-N-propan-2-ylacetamide |
| SMILES | Cc1cn(CC(=O)NC(C)C)c(=S)[nH]1 |
| InChI | InChI=1S/C9H15N3OS/c1-6(2)10-8(13)5-12-4-7(3)11-9(12)14/h4,6H,5H2,1-3H3,(H,10,13)(H,11,14) |
| InChIKey | JMQLXWHIWUATQR-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 49.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|