C11H18N2S — CID 81336195
5-methyl-3-(3-methylcyclohexyl)-1H-imidazole-2-thione (PubChem CID 81336195) has the molecular formula C11H18N2S and a molecular weight of 210.35 g/mol. Its IUPAC name is 5-methyl-3-(3-methylcyclohexyl)-1H-imidazole-2-thione.
| Compound Name | 5-methyl-3-(3-methylcyclohexyl)-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 81336195 |
| Molecular Formula | C11H18N2S |
| Molecular Weight | 210.35 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 5-methyl-3-(3-methylcyclohexyl)-1H-imidazole-2-thione |
| SMILES | Cc1cn(C2CCCC(C)C2)c(=S)[nH]1 |
| InChI | InChI=1S/C11H18N2S/c1-8-4-3-5-10(6-8)13-7-9(2)12-11(13)14/h7-8,10H,3-6H2,1-2H3,(H,12,14) |
| InChIKey | OYDBUZHKUCMHJN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.35 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|