About 4-tert-butyl-3-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1H-imidazole-2-thione
4-tert-butyl-3-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1H-imidazole-2-thione (PubChem CID 81336241) has the molecular formula C15H22N2S2
and a molecular weight of 294.49 g/mol. Its IUPAC name is 4-tert-butyl-3-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1H-imidazole-2-thione.
Molecular Properties
| Compound Name | 4-tert-butyl-3-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1H-imidazole-2-thione |
| PubChem CID | 81336241 |
| Molecular Formula | C15H22N2S2 |
| Molecular Weight | 294.49 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 4-tert-butyl-3-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1H-imidazole-2-thione |
| SMILES | Cc1cc(C(C)n2c(C(C)(C)C)c[nH]c2=S)c(C)s1 |
| InChI | InChI=1S/C15H22N2S2/c1-9-7-12(11(3)19-9)10(2)17-13(15(4,5)6)8-16-14(17)18/h7-8,10H,1-6H3,(H,16,18) |
| InChIKey | ZBNNJPWJXAFTCY-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.49 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-tert-butyl-3-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1H-imidazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-3-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1H-imidazole-2-thione?
The IUPAC name of 4-tert-butyl-3-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1H-imidazole-2-thione (CID 81336241) is 4-tert-butyl-3-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1H-imidazole-2-thione.
What is the SMILES notation for 4-tert-butyl-3-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1H-imidazole-2-thione?
The canonical SMILES for 4-tert-butyl-3-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1H-imidazole-2-thione is Cc1cc(C(C)n2c(C(C)(C)C)c[nH]c2=S)c(C)s1.
What is the InChIKey of 4-tert-butyl-3-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1H-imidazole-2-thione?
The InChIKey is ZBNNJPWJXAFTCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2S2/c1-9-7-12(11(3)19-9)10(2)17-13(15(4,5)6)8-16-14(17)18/h7-8,10H,1-6H3,(H,16,18).
What are the key properties of 4-tert-butyl-3-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1H-imidazole-2-thione?
4-tert-butyl-3-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1H-imidazole-2-thione has a molecular weight of 294.49 g/mol, XLogP of 5.13, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-3-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1H-imidazole-2-thione is sourced from PubChem (CID 81336241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).