C13H23N3OS — CID 81336357
2-(4-tert-butyl-2-sulfanylidene-1H-imidazol-3-yl)-N-propylpropanamide (PubChem CID 81336357) has the molecular formula C13H23N3OS and a molecular weight of 269.41 g/mol. Its IUPAC name is 2-(4-tert-butyl-2-sulfanylidene-1H-imidazol-3-yl)-N-propylpropanamide.
| Compound Name | 2-(4-tert-butyl-2-sulfanylidene-1H-imidazol-3-yl)-N-propylpropanamide |
|---|---|
| PubChem CID | 81336357 |
| Molecular Formula | C13H23N3OS |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 2-(4-tert-butyl-2-sulfanylidene-1H-imidazol-3-yl)-N-propylpropanamide |
| SMILES | CCCNC(=O)C(C)n1c(C(C)(C)C)c[nH]c1=S |
| InChI | InChI=1S/C13H23N3OS/c1-6-7-14-11(17)9(2)16-10(13(3,4)5)8-15-12(16)18/h8-9H,6-7H2,1-5H3,(H,14,17)(H,15,18) |
| InChIKey | RGGUGKPSMUNSJF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 49.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|