C12H19N3O2S — CID 81336575
2-[5-methyl-1-(2-pyrrolidin-1-ylethyl)imidazol-2-yl]sulfanylacetic acid (PubChem CID 81336575) has the molecular formula C12H19N3O2S and a molecular weight of 269.37 g/mol. Its IUPAC name is 2-[5-methyl-1-(2-pyrrolidin-1-ylethyl)imidazol-2-yl]sulfanylacetic acid.
| Compound Name | 2-[5-methyl-1-(2-pyrrolidin-1-ylethyl)imidazol-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 81336575 |
| Molecular Formula | C12H19N3O2S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 2-[5-methyl-1-(2-pyrrolidin-1-ylethyl)imidazol-2-yl]sulfanylacetic acid |
| SMILES | Cc1cnc(SCC(=O)O)n1CCN1CCCC1 |
| InChI | InChI=1S/C12H19N3O2S/c1-10-8-13-12(18-9-11(16)17)15(10)7-6-14-4-2-3-5-14/h8H,2-7,9H2,1H3,(H,16,17) |
| InChIKey | HBNBOLKWHHZKIK-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |