C11H18F3N3O3S — CID 81337149
2-propan-2-yl-1-[3-(2,2,2-trifluoroethoxy)propyl]imidazole-4-sulfonamide (PubChem CID 81337149) has the molecular formula C11H18F3N3O3S and a molecular weight of 329.34 g/mol. Its IUPAC name is 2-propan-2-yl-1-[3-(2,2,2-trifluoroethoxy)propyl]imidazole-4-sulfonamide.
| Compound Name | 2-propan-2-yl-1-[3-(2,2,2-trifluoroethoxy)propyl]imidazole-4-sulfonamide |
|---|---|
| PubChem CID | 81337149 |
| Molecular Formula | C11H18F3N3O3S |
| Molecular Weight | 329.34 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 2-propan-2-yl-1-[3-(2,2,2-trifluoroethoxy)propyl]imidazole-4-sulfonamide |
| SMILES | CC(C)c1nc(S(N)(=O)=O)cn1CCCOCC(F)(F)F |
| InChI | InChI=1S/C11H18F3N3O3S/c1-8(2)10-16-9(21(15,18)19)6-17(10)4-3-5-20-7-11(12,13)14/h6,8H,3-5,7H2,1-2H3,(H2,15,18,19) |
| InChIKey | CJJBZOWYLLFVQB-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.34 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|