C12H9F3N2O2S — CID 81337694
2-[4-methyl-1-(2,3,4-trifluorophenyl)imidazol-2-yl]sulfanylacetic acid (PubChem CID 81337694) has the molecular formula C12H9F3N2O2S and a molecular weight of 302.28 g/mol. Its IUPAC name is 2-[4-methyl-1-(2,3,4-trifluorophenyl)imidazol-2-yl]sulfanylacetic acid.
| Compound Name | 2-[4-methyl-1-(2,3,4-trifluorophenyl)imidazol-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 81337694 |
| Molecular Formula | C12H9F3N2O2S |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | 2-[4-methyl-1-(2,3,4-trifluorophenyl)imidazol-2-yl]sulfanylacetic acid |
| SMILES | Cc1cn(-c2ccc(F)c(F)c2F)c(SCC(=O)O)n1 |
| InChI | InChI=1S/C12H9F3N2O2S/c1-6-4-17(12(16-6)20-5-9(18)19)8-3-2-7(13)10(14)11(8)15/h2-4H,5H2,1H3,(H,18,19) |
| InChIKey | LCFAGUOWKIOSPK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|